C24H23F3N2O2 — CID 46308658
1-(3-ethoxypropyl)-2-(naphthalen-2-yloxymethyl)-5-(trifluoromethyl)benzimidazole (PubChem CID 46308658) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-(naphthalen-2-yloxymethyl)-5-(trifluoromethyl)benzimidazole.
| Compound Name | 1-(3-ethoxypropyl)-2-(naphthalen-2-yloxymethyl)-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 46308658 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-(naphthalen-2-yloxymethyl)-5-(trifluoromethyl)benzimidazole |
| SMILES | CCOCCCn1c(COc2ccc3ccccc3c2)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C24H23F3N2O2/c1-2-30-13-5-12-29-22-11-9-19(24(25,26)27)15-21(22)28-23(29)16-31-20-10-8-17-6-3-4-7-18(17)14-20/h3-4,6-11,14-15H,2,5,12-13,16H2,1H3 |
| InChIKey | KWPKBJDZECXPNK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|