C20H20ClF3N2OS — CID 46308669
2-[(4-chlorophenyl)sulfanylmethyl]-1-(3-ethoxypropyl)-5-(trifluoromethyl)benzimidazole (PubChem CID 46308669) has the molecular formula C20H20ClF3N2OS and a molecular weight of 428.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-1-(3-ethoxypropyl)-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1-(3-ethoxypropyl)-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 46308669 |
| Molecular Formula | C20H20ClF3N2OS |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1-(3-ethoxypropyl)-5-(trifluoromethyl)benzimidazole |
| SMILES | CCOCCCn1c(CSc2ccc(Cl)cc2)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H20ClF3N2OS/c1-2-27-11-3-10-26-18-9-4-14(20(22,23)24)12-17(18)25-19(26)13-28-16-7-5-15(21)6-8-16/h4-9,12H,2-3,10-11,13H2,1H3 |
| InChIKey | IWBMBYBHSGVPOE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|