C21H23F3N2O3 — CID 46309205
2-[(3,4-dimethoxyphenyl)methyl]-1-(2-ethoxyethyl)-5-(trifluoromethyl)benzimidazole (PubChem CID 46309205) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-ethoxyethyl)-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-ethoxyethyl)-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 46309205 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-ethoxyethyl)-5-(trifluoromethyl)benzimidazole |
| SMILES | CCOCCn1c(Cc2ccc(OC)c(OC)c2)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H23F3N2O3/c1-4-29-10-9-26-17-7-6-15(21(22,23)24)13-16(17)25-20(26)12-14-5-8-18(27-2)19(11-14)28-3/h5-8,11,13H,4,9-10,12H2,1-3H3 |
| InChIKey | DQHMWJIMFNLAAV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|