About 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole
5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole (PubChem CID 46310881) has the molecular formula C20H23ClN2O2
and a molecular weight of 358.87 g/mol. Its IUPAC name is 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole |
| PubChem CID | 46310881 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole |
| SMILES | COc1ccc(Cc2nc3cc(Cl)ccc3n2CC(C)C)cc1OC |
| InChI | InChI=1S/C20H23ClN2O2/c1-13(2)12-23-17-7-6-15(21)11-16(17)22-20(23)10-14-5-8-18(24-3)19(9-14)25-4/h5-9,11,13H,10,12H2,1-4H3 |
| InChIKey | KRIZUJGFIWGNFG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole?
The IUPAC name of 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole (CID 46310881) is 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole.
What is the SMILES notation for 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole?
The canonical SMILES for 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole is COc1ccc(Cc2nc3cc(Cl)ccc3n2CC(C)C)cc1OC.
What is the InChIKey of 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole?
The InChIKey is KRIZUJGFIWGNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClN2O2/c1-13(2)12-23-17-7-6-15(21)11-16(17)22-20(23)10-14-5-8-18(24-3)19(9-14)25-4/h5-9,11,13H,10,12H2,1-4H3.
What are the key properties of 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole?
5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole has a molecular weight of 358.87 g/mol, XLogP of 4.95, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpropyl)benzimidazole is sourced from PubChem (CID 46310881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).