C24H32N2O2 — CID 18878494
2-[(3,4-dimethoxyphenyl)methyl]-1-octylbenzimidazole (PubChem CID 18878494) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-octylbenzimidazole.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-octylbenzimidazole |
|---|---|
| PubChem CID | 18878494 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-octylbenzimidazole |
| SMILES | CCCCCCCCn1c(Cc2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H32N2O2/c1-4-5-6-7-8-11-16-26-21-13-10-9-12-20(21)25-24(26)18-19-14-15-22(27-2)23(17-19)28-3/h9-10,12-15,17H,4-8,11,16,18H2,1-3H3 |
| InChIKey | BBNOQBVXQSBWFF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|