C17H15F3N2O2S — CID 67984963
2-(2-ethylsulfonylphenyl)-1-methyl-5-(trifluoromethyl)benzimidazole (PubChem CID 67984963) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is 2-(2-ethylsulfonylphenyl)-1-methyl-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-(2-ethylsulfonylphenyl)-1-methyl-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 67984963 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(2-ethylsulfonylphenyl)-1-methyl-5-(trifluoromethyl)benzimidazole |
| SMILES | CCS(=O)(=O)c1ccccc1-c1nc2cc(C(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C17H15F3N2O2S/c1-3-25(23,24)15-7-5-4-6-12(15)16-21-13-10-11(17(18,19)20)8-9-14(13)22(16)2/h4-10H,3H2,1-2H3 |
| InChIKey | ICOTZXWDJFCIDF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |