C24H31F3N6O2Si — CID 59333360
3-[[1-[5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol (PubChem CID 59333360) has the molecular formula C24H31F3N6O2Si and a molecular weight of 520.63 g/mol. Its IUPAC name is 3-[[1-[5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[1-[5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 59333360 |
| Molecular Formula | C24H31F3N6O2Si |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 3-[[1-[5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
| SMILES | Cc1cc(-c2cnc3c(NCCCO)nc4cc(C(F)(F)F)ccc4n23)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C24H31F3N6O2Si/c1-16-12-20(32(31-16)15-35-10-11-36(2,3)4)21-14-29-23-22(28-8-5-9-34)30-18-13-17(24(25,26)27)6-7-19(18)33(21)23/h6-7,12-14,34H,5,8-11,15H2,1-4H3,(H,28,30) |
| InChIKey | OJCSFBYICAWLQO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|