C23H29F3N6OSi — CID 123561008
N-propyl-7-(trifluoromethyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-a]quinoxalin-4-amine (PubChem CID 123561008) has the molecular formula C23H29F3N6OSi and a molecular weight of 490.61 g/mol. Its IUPAC name is N-propyl-7-(trifluoromethyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-a]quinoxalin-4-amine.
| Compound Name | N-propyl-7-(trifluoromethyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 123561008 |
| Molecular Formula | C23H29F3N6OSi |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-propyl-7-(trifluoromethyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-a]quinoxalin-4-amine |
| SMILES | CCCNc1nc2cc(C(F)(F)F)ccc2n2c(-c3ccnn3COCC[Si](C)(C)C)cnc12 |
| InChI | InChI=1S/C23H29F3N6OSi/c1-5-9-27-21-22-28-14-20(19-8-10-29-31(19)15-33-11-12-34(2,3)4)32(22)18-7-6-16(23(24,25)26)13-17(18)30-21/h6-8,10,13-14H,5,9,11-12,15H2,1-4H3,(H,27,30) |
| InChIKey | MGXLXFJDSGTTKA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|