C14H12BF3N4O — CID 89240854
CID 89240854 (PubChem CID 89240854) has the molecular formula C14H12BF3N4O and a molecular weight of 320.08 g/mol.
| Compound Name | CID 89240854 |
|---|---|
| PubChem CID | 89240854 |
| Molecular Formula | C14H12BF3N4O |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2c(NCCCO)nc3cc(C(F)(F)F)ccc3n12 |
| InChI | InChI=1S/C14H12BF3N4O/c15-11-7-20-13-12(19-4-1-5-23)21-9-6-8(14(16,17)18)2-3-10(9)22(11)13/h2-3,6-7,23H,1,4-5H2,(H,19,21) |
| InChIKey | ISIGRYRDNNNVHV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|