C22H34F3N3O — CID 46309614
3-[1-[3-(dibutylamino)propyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-1-ol (PubChem CID 46309614) has the molecular formula C22H34F3N3O and a molecular weight of 413.53 g/mol. Its IUPAC name is 3-[1-[3-(dibutylamino)propyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-1-ol.
| Compound Name | 3-[1-[3-(dibutylamino)propyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 46309614 |
| Molecular Formula | C22H34F3N3O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 3-[1-[3-(dibutylamino)propyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-1-ol |
| SMILES | CCCCN(CCCC)CCCn1c(CCCO)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H34F3N3O/c1-3-5-12-27(13-6-4-2)14-8-15-28-20-11-10-18(22(23,24)25)17-19(20)26-21(28)9-7-16-29/h10-11,17,29H,3-9,12-16H2,1-2H3 |
| InChIKey | WMBFRQHKPUKUQN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |