C20H31F3N4 — CID 46309723
N-[3-[2-(aminomethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine (PubChem CID 46309723) has the molecular formula C20H31F3N4 and a molecular weight of 384.49 g/mol. Its IUPAC name is N-[3-[2-(aminomethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine.
| Compound Name | N-[3-[2-(aminomethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine |
|---|---|
| PubChem CID | 46309723 |
| Molecular Formula | C20H31F3N4 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | N-[3-[2-(aminomethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCCn1c(CN)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H31F3N4/c1-3-5-10-26(11-6-4-2)12-7-13-27-18-9-8-16(20(21,22)23)14-17(18)25-19(27)15-24/h8-9,14H,3-7,10-13,15,24H2,1-2H3 |
| InChIKey | LGHMJZDKHGHQRH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |