C22H35F3N4 — CID 46309733
N-[3-[2-(3-aminopropyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine (PubChem CID 46309733) has the molecular formula C22H35F3N4 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[3-[2-(3-aminopropyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine.
| Compound Name | N-[3-[2-(3-aminopropyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine |
|---|---|
| PubChem CID | 46309733 |
| Molecular Formula | C22H35F3N4 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | N-[3-[2-(3-aminopropyl)-5-(trifluoromethyl)benzimidazol-1-yl]propyl]-N-butylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCCn1c(CCCN)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H35F3N4/c1-3-5-13-28(14-6-4-2)15-8-16-29-20-11-10-18(22(23,24)25)17-19(20)27-21(29)9-7-12-26/h10-11,17H,3-9,12-16,26H2,1-2H3 |
| InChIKey | YJLUJDHTLQUQQE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |