C32H43N5O6Si — CID 176886388
benzyl 4-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]piperazine-1-carboxylate (PubChem CID 176886388) has the molecular formula C32H43N5O6Si and a molecular weight of 621.81 g/mol. Its IUPAC name is benzyl 4-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176886388 |
| Molecular Formula | C32H43N5O6Si |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | benzyl 4-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]piperazine-1-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)N(COCC[Si](C)(C)C)C2=O)c2ccc(CN3CCN(C(=O)OCc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C32H43N5O6Si/c1-33-28-20-25(21-34-14-16-35(17-15-34)32(41)43-22-24-8-6-5-7-9-24)10-11-26(28)37(31(33)40)27-12-13-29(38)36(30(27)39)23-42-18-19-44(2,3)4/h5-11,20,27H,12-19,21-23H2,1-4H3 |
| InChIKey | MVVVMNUVDWLQRH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 106.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|