C21H28N4O6Si — CID 176886421
3-(7-nitro-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 176886421) has the molecular formula C21H28N4O6Si and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-(7-nitro-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-(7-nitro-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176886421 |
| Molecular Formula | C21H28N4O6Si |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-(7-nitro-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CCC(n2c(=O)n3c4c(c([N+](=O)[O-])ccc42)CCC3)C1=O |
| InChI | InChI=1S/C21H28N4O6Si/c1-32(2,3)12-11-31-13-23-18(26)9-8-17(20(23)27)24-16-7-6-15(25(29)30)14-5-4-10-22(19(14)16)21(24)28/h6-7,17H,4-5,8-13H2,1-3H3 |
| InChIKey | DDSDKOSMOSZIMJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 116.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|