C28H43N5O6Si — CID 176886457
tert-butyl N-[3-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]amino]cyclobutyl]carbamate (PubChem CID 176886457) has the molecular formula C28H43N5O6Si and a molecular weight of 573.77 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 176886457 |
| Molecular Formula | C28H43N5O6Si |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | tert-butyl N-[3-[[1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]amino]cyclobutyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)N(COCC[Si](C)(C)C)C2=O)c2ccc(NC3CC(NC(=O)OC(C)(C)C)C3)cc21 |
| InChI | InChI=1S/C28H43N5O6Si/c1-28(2,3)39-26(36)30-20-14-19(15-20)29-18-8-9-21-23(16-18)31(4)27(37)33(21)22-10-11-24(34)32(25(22)35)17-38-12-13-40(5,6)7/h8-9,16,19-20,22,29H,10-15,17H2,1-7H3,(H,30,36) |
| InChIKey | HTAZXFWWVJSIJI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|