C31H47N3O7Si — CID 153313010
tert-butyl N-[(1S,2S)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]cycloheptyl]carbamate (PubChem CID 153313010) has the molecular formula C31H47N3O7Si and a molecular weight of 601.82 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 153313010 |
| Molecular Formula | C31H47N3O7Si |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]cycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCC[C@@H]1Oc1ccc2c(c1)CN(C1CCC(=O)N(COCC[Si](C)(C)C)C1=O)C2=O |
| InChI | InChI=1S/C31H47N3O7Si/c1-31(2,3)41-30(38)32-24-10-8-7-9-11-26(24)40-22-12-13-23-21(18-22)19-33(28(23)36)25-14-15-27(35)34(29(25)37)20-39-16-17-42(4,5)6/h12-13,18,24-26H,7-11,14-17,19-20H2,1-6H3,(H,32,38)/t24-,25?,26-/m0/s1 |
| InChIKey | QYMYYDSNELPNDJ-ZURQMKNRSA-N |
| XLogP | 5.08 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|