C34H47N3O4Si — CID 174057932
3-[3-oxo-6-[[(1R,2S)-2-(1-phenylethylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 174057932) has the molecular formula C34H47N3O4Si and a molecular weight of 589.85 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(1R,2S)-2-(1-phenylethylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(1R,2S)-2-(1-phenylethylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 174057932 |
| Molecular Formula | C34H47N3O4Si |
| Molecular Weight | 589.85 g/mol |
| Exact Mass | 589.33 |
| IUPAC Name | 3-[3-oxo-6-[[(1R,2S)-2-(1-phenylethylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | CC(N[C@H]1CCCC[C@@H]1Cc1ccc2c(c1)CN(C1CCC(=O)N(COCC[Si](C)(C)C)C1=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C34H47N3O4Si/c1-24(26-10-6-5-7-11-26)35-30-13-9-8-12-27(30)20-25-14-15-29-28(21-25)22-36(33(29)39)31-16-17-32(38)37(34(31)40)23-41-18-19-42(2,3)4/h5-7,10-11,14-15,21,24,27,30-31,35H,8-9,12-13,16-20,22-23H2,1-4H3/t24?,27-,30+,31?/m1/s1 |
| InChIKey | ZRHGTSAQRCFUPS-XSBPDBKBSA-N |
| XLogP | 5.92 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.85 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|