C32H44N4O4Si — CID 168960538
3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 168960538) has the molecular formula C32H44N4O4Si and a molecular weight of 576.81 g/mol. Its IUPAC name is 3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 168960538 |
| Molecular Formula | C32H44N4O4Si |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CCC(N2Cc3cc(CNC4CCN(Cc5ccccc5)CC4)ccc3C2=O)C1=O |
| InChI | InChI=1S/C32H44N4O4Si/c1-41(2,3)18-17-40-23-36-30(37)12-11-29(32(36)39)35-22-26-19-25(9-10-28(26)31(35)38)20-33-27-13-15-34(16-14-27)21-24-7-5-4-6-8-24/h4-10,19,27,29,33H,11-18,20-23H2,1-3H3 |
| InChIKey | ALRUCMNIRJIHMP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|