C34H50N4O4S — CID 168960419
3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-[2-(1-methylthiiran-1-yl)ethoxymethyl]piperidine-2,6-dione;ethane;molecular hydrogen (PubChem CID 168960419) has the molecular formula C34H50N4O4S and a molecular weight of 610.87 g/mol. Its IUPAC name is 3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-[2-(1-methylthiiran-1-yl)ethoxymethyl]piperidine-2,6-dione;ethane;molecular hydrogen.
| Compound Name | 3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-[2-(1-methylthiiran-1-yl)ethoxymethyl]piperidine-2,6-dione;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 168960419 |
| Molecular Formula | C34H50N4O4S |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | 3-[6-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]-1-[2-(1-methylthiiran-1-yl)ethoxymethyl]piperidine-2,6-dione;ethane;molecular hydrogen |
| SMILES | CC.CS1(CCOCN2C(=O)CCC(N3Cc4cc(CNC5CCN(Cc6ccccc6)CC5)ccc4C3=O)C2=O)CC1.[H][H] |
| InChI | InChI=1S/C32H42N4O4S.C2H6.H2/c1-41(17-18-41)16-15-40-23-36-30(37)10-9-29(32(36)39)35-22-26-19-25(7-8-28(26)31(35)38)20-33-27-11-13-34(14-12-27)21-24-5-3-2-4-6-24;1-2;/h2-8,19,27,29,33H,9-18,20-23H2,1H3;1-2H3;1H |
| InChIKey | WQFYJYKNCLVYSO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|