C28H41N3O7Si — CID 174050252
[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]carbamic acid (PubChem CID 174050252) has the molecular formula C28H41N3O7Si and a molecular weight of 559.74 g/mol. Its IUPAC name is [2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]carbamic acid.
| Compound Name | [2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174050252 |
| Molecular Formula | C28H41N3O7Si |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | [2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]carbamic acid |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CCC(N2Cc3cc(CN(C(=O)O)[C@H]4CCCC[C@H]4CO)ccc3C2=O)C1=O |
| InChI | InChI=1S/C28H41N3O7Si/c1-39(2,3)13-12-38-18-31-25(33)11-10-24(27(31)35)29-16-21-14-19(8-9-22(21)26(29)34)15-30(28(36)37)23-7-5-4-6-20(23)17-32/h8-9,14,20,23-24,32H,4-7,10-13,15-18H2,1-3H3,(H,36,37)/t20-,23-,24?/m0/s1 |
| InChIKey | XJCQFVGJEJXQCA-AEPCKBASSA-N |
| XLogP | 3.50 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|