C31H45N3O7Si — CID 153312965
tert-butyl (3aR,6S,6aS)-6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 153312965) has the molecular formula C31H45N3O7Si and a molecular weight of 599.80 g/mol. Its IUPAC name is tert-butyl (3aR,6S,6aS)-6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aR,6S,6aS)-6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 153312965 |
| Molecular Formula | C31H45N3O7Si |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | tert-butyl (3aR,6S,6aS)-6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2CC[C@H](Oc3ccc4c(c3)CN(C3CCC(=O)N(COCC[Si](C)(C)C)C3=O)C4=O)[C@H]21 |
| InChI | InChI=1S/C31H45N3O7Si/c1-31(2,3)41-30(38)32-14-13-20-7-11-25(27(20)32)40-22-8-9-23-21(17-22)18-33(28(23)36)24-10-12-26(35)34(29(24)37)19-39-15-16-42(4,5)6/h8-9,17,20,24-25,27H,7,10-16,18-19H2,1-6H3/t20-,24?,25+,27+/m1/s1 |
| InChIKey | JYCBWBPLBREMSD-GWEVXTKJSA-N |
| XLogP | 4.64 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|