C24H34N2O6Si — CID 153312981
3-[6-[(3R,4S)-4-methyloxolan-3-yl]oxy-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 153312981) has the molecular formula C24H34N2O6Si and a molecular weight of 474.63 g/mol. Its IUPAC name is 3-[6-[(3R,4S)-4-methyloxolan-3-yl]oxy-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-[6-[(3R,4S)-4-methyloxolan-3-yl]oxy-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 153312981 |
| Molecular Formula | C24H34N2O6Si |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 3-[6-[(3R,4S)-4-methyloxolan-3-yl]oxy-3-oxo-1H-isoindol-2-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | C[C@H]1COC[C@@H]1Oc1ccc2c(c1)CN(C1CCC(=O)N(COCC[Si](C)(C)C)C1=O)C2=O |
| InChI | InChI=1S/C24H34N2O6Si/c1-16-13-31-14-21(16)32-18-5-6-19-17(11-18)12-25(23(19)28)20-7-8-22(27)26(24(20)29)15-30-9-10-33(2,3)4/h5-6,11,16,20-21H,7-10,12-15H2,1-4H3/t16-,20?,21-/m0/s1 |
| InChIKey | DWRCHSUBZXNSDD-SVPGJFCKSA-N |
| XLogP | 2.89 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|