C30H43N3O7Si — CID 166154091
tert-butyl 6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 166154091) has the molecular formula C30H43N3O7Si and a molecular weight of 585.77 g/mol. Its IUPAC name is tert-butyl 6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 166154091 |
| Molecular Formula | C30H43N3O7Si |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | tert-butyl 6-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(Oc3ccc4c(c3)CN(C3CCC(=O)N(COCC[Si](C)(C)C)C3=O)C4=O)C1C2 |
| InChI | InChI=1S/C30H43N3O7Si/c1-30(2,3)40-29(37)32-16-19-13-24(32)25(14-19)39-21-7-8-22-20(15-21)17-31(27(22)35)23-9-10-26(34)33(28(23)36)18-38-11-12-41(4,5)6/h7-8,15,19,23-25H,9-14,16-18H2,1-6H3 |
| InChIKey | DQAGGPRQLDTTJR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|