C31H46FN3O6Si — CID 169068120
tert-butyl N-[(1S,2R)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate (PubChem CID 169068120) has the molecular formula C31H46FN3O6Si and a molecular weight of 603.81 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 169068120 |
| Molecular Formula | C31H46FN3O6Si |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1Cc1cc2c(cc1F)C(=O)N(C1CCC(=O)N(COCC[Si](C)(C)C)C1=O)C2 |
| InChI | InChI=1S/C31H46FN3O6Si/c1-31(2,3)41-30(39)33-25-10-8-7-9-20(25)15-21-16-22-18-34(28(37)23(22)17-24(21)32)26-11-12-27(36)35(29(26)38)19-40-13-14-42(4,5)6/h16-17,20,25-26H,7-15,18-19H2,1-6H3,(H,33,39)/t20-,25+,26?/m1/s1 |
| InChIKey | OYXNGEUIAUPDNK-ACIRKUTISA-N |
| XLogP | 5.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|