C30H45N3O7Si — CID 166154226
tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]azepane-1-carboxylate (PubChem CID 166154226) has the molecular formula C30H45N3O7Si and a molecular weight of 587.79 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]azepane-1-carboxylate |
|---|---|
| PubChem CID | 166154226 |
| Molecular Formula | C30H45N3O7Si |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H](Oc2ccc3c(c2)CN(C2CCC(=O)N(COCC[Si](C)(C)C)C2=O)C3=O)C1 |
| InChI | InChI=1S/C30H45N3O7Si/c1-30(2,3)40-29(37)31-14-8-7-9-23(19-31)39-22-10-11-24-21(17-22)18-32(27(24)35)25-12-13-26(34)33(28(25)36)20-38-15-16-41(4,5)6/h10-11,17,23,25H,7-9,12-16,18-20H2,1-6H3/t23-,25?/m1/s1 |
| InChIKey | LWTJTIUOKFVTDG-XQZUBTRRSA-N |
| XLogP | 4.64 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|