C29H43N3O7Si — CID 166154254
tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]piperidine-1-carboxylate (PubChem CID 166154254) has the molecular formula C29H43N3O7Si and a molecular weight of 573.76 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166154254 |
| Molecular Formula | C29H43N3O7Si |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | tert-butyl (3R)-3-[[2-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-1-oxo-3H-isoindol-5-yl]oxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Oc2ccc3c(c2)CN(C2CCC(=O)N(COCC[Si](C)(C)C)C2=O)C3=O)C1 |
| InChI | InChI=1S/C29H43N3O7Si/c1-29(2,3)39-28(36)30-13-7-8-22(18-30)38-21-9-10-23-20(16-21)17-31(26(23)34)24-11-12-25(33)32(27(24)35)19-37-14-15-40(4,5)6/h9-10,16,22,24H,7-8,11-15,17-19H2,1-6H3/t22-,24?/m1/s1 |
| InChIKey | FFXRHFJBRMZJMZ-LETIRJCYSA-N |
| XLogP | 4.25 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|