C29H26N4O6 — CID 59443299
[2,6-dioxo-3-[3-oxo-6-[(phenylcarbamoylamino)methyl]-1H-isoindol-2-yl]piperidin-1-yl]methyl benzoate (PubChem CID 59443299) has the molecular formula C29H26N4O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is [2,6-dioxo-3-[3-oxo-6-[(phenylcarbamoylamino)methyl]-1H-isoindol-2-yl]piperidin-1-yl]methyl benzoate.
| Compound Name | [2,6-dioxo-3-[3-oxo-6-[(phenylcarbamoylamino)methyl]-1H-isoindol-2-yl]piperidin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 59443299 |
| Molecular Formula | C29H26N4O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [2,6-dioxo-3-[3-oxo-6-[(phenylcarbamoylamino)methyl]-1H-isoindol-2-yl]piperidin-1-yl]methyl benzoate |
| SMILES | O=C(NCc1ccc2c(c1)CN(C1CCC(=O)N(COC(=O)c3ccccc3)C1=O)C2=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H26N4O6/c34-25-14-13-24(27(36)33(25)18-39-28(37)20-7-3-1-4-8-20)32-17-21-15-19(11-12-23(21)26(32)35)16-30-29(38)31-22-9-5-2-6-10-22/h1-12,15,24H,13-14,16-18H2,(H2,30,31,38) |
| InChIKey | OIMNBNVBRVXWEQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|