C27H29ClF2N3O8P — CID 130219291
[3-[6-[[[2-(4-chlorophenyl)-2,2-difluoroacetyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl diethyl phosphate (PubChem CID 130219291) has the molecular formula C27H29ClF2N3O8P and a molecular weight of 627.97 g/mol. Its IUPAC name is [3-[6-[[[2-(4-chlorophenyl)-2,2-difluoroacetyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl diethyl phosphate.
| Compound Name | [3-[6-[[[2-(4-chlorophenyl)-2,2-difluoroacetyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 130219291 |
| Molecular Formula | C27H29ClF2N3O8P |
| Molecular Weight | 627.97 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | [3-[6-[[[2-(4-chlorophenyl)-2,2-difluoroacetyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCN1C(=O)CCC(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(Cl)cc4)ccc3C2=O)C1=O |
| InChI | InChI=1S/C27H29ClF2N3O8P/c1-3-39-42(38,40-4-2)41-16-33-23(34)12-11-22(25(33)36)32-15-18-13-17(5-10-21(18)24(32)35)14-31-26(37)27(29,30)19-6-8-20(28)9-7-19/h5-10,13,22H,3-4,11-12,14-16H2,1-2H3,(H,31,37) |
| InChIKey | CIWCDHJRBYYSFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|