C24H27N4O8P — CID 146492035
[3-[6-[[[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]carbamoylamino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl dihydrogen phosphate (PubChem CID 146492035) has the molecular formula C24H27N4O8P and a molecular weight of 530.47 g/mol. Its IUPAC name is [3-[6-[[[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]carbamoylamino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[6-[[[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]carbamoylamino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 146492035 |
| Molecular Formula | C24H27N4O8P |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | [3-[6-[[[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]carbamoylamino]methyl]-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]methyl dihydrogen phosphate |
| SMILES | C=C/C=C\C(=C/C=C)NC(=O)NCc1ccc2c(c1)CN(C1CCC(=O)N(COP(=O)(O)O)C1=O)C2=O |
| InChI | InChI=1S/C24H27N4O8P/c1-3-5-7-18(6-4-2)26-24(32)25-13-16-8-9-19-17(12-16)14-27(22(19)30)20-10-11-21(29)28(23(20)31)15-36-37(33,34)35/h3-9,12,20H,1-2,10-11,13-15H2,(H2,25,26,32)(H2,33,34,35)/b7-5-,18-6+ |
| InChIKey | KMBPWQDWHAZSOY-SRRQOFNWSA-N |
| XLogP | 1.84 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|