C50H56N6O3 — CID 174225080
1-benzyl-5-phenylpiperidin-3-amine;3-[6-[[(1-benzyl-5-phenylpiperidin-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174225080) has the molecular formula C50H56N6O3 and a molecular weight of 789.04 g/mol. Its IUPAC name is 1-benzyl-5-phenylpiperidin-3-amine;3-[6-[[(1-benzyl-5-phenylpiperidin-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 1-benzyl-5-phenylpiperidin-3-amine;3-[6-[[(1-benzyl-5-phenylpiperidin-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174225080 |
| Molecular Formula | C50H56N6O3 |
| Molecular Weight | 789.04 g/mol |
| Exact Mass | 788.44 |
| IUPAC Name | 1-benzyl-5-phenylpiperidin-3-amine;3-[6-[[(1-benzyl-5-phenylpiperidin-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC1CC(c2ccccc2)CN(Cc2ccccc2)C1.O=C1CCC(N2Cc3cc(CNC4CC(c5ccccc5)CN(Cc5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H34N4O3.C18H22N2/c37-30-14-13-29(31(38)34-30)36-20-26-15-23(11-12-28(26)32(36)39)17-33-27-16-25(24-9-5-2-6-10-24)19-35(21-27)18-22-7-3-1-4-8-22;19-18-11-17(16-9-5-2-6-10-16)13-20(14-18)12-15-7-3-1-4-8-15/h1-12,15,25,27,29,33H,13-14,16-21H2,(H,34,37,38);1-10,17-18H,11-14,19H2 |
| InChIKey | LYGKUMWFIQSCRY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.04 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|