C27H31N3O4 — CID 168960455
3-[6-[[[(1R,3S)-3-[(S)-hydroxy(phenyl)methyl]cyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168960455) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[6-[[[(1R,3S)-3-[(S)-hydroxy(phenyl)methyl]cyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[[(1R,3S)-3-[(S)-hydroxy(phenyl)methyl]cyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168960455 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[6-[[[(1R,3S)-3-[(S)-hydroxy(phenyl)methyl]cyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN[C@@H]4CCC[C@H]([C@H](O)c5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H31N3O4/c31-24-12-11-23(26(33)29-24)30-16-20-13-17(9-10-22(20)27(30)34)15-28-21-8-4-7-19(14-21)25(32)18-5-2-1-3-6-18/h1-3,5-6,9-10,13,19,21,23,25,28,32H,4,7-8,11-12,14-16H2,(H,29,31,33)/t19-,21+,23?,25+/m0/s1 |
| InChIKey | VJODVFLYWVPCFH-XGSGKDQOSA-N |
| XLogP | 2.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|