C21H24N4O3 — CID 168960682
trans-(1R,3R)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]cyclohexane-1-carbonitrile (PubChem CID 168960682) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is trans-(1R,3R)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]cyclohexane-1-carbonitrile.
| Compound Name | trans-(1R,3R)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 168960682 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | trans-(1R,3R)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]cyclohexane-1-carbonitrile |
| SMILES | N#C[C@@H]1CCC[C@@H](NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C21H24N4O3/c22-10-13-2-1-3-16(9-13)23-11-14-4-5-17-15(8-14)12-25(21(17)28)18-6-7-19(26)24-20(18)27/h4-5,8,13,16,18,23H,1-3,6-7,9,11-12H2,(H,24,26,27)/t13-,16-,18?/m1/s1 |
| InChIKey | FWSIUZUTGRGUDU-HZBOCPGUSA-N |
| XLogP | 1.62 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|