C20H25FN4O3 — CID 167735791
3-[6-[[[(1S,3R)-3-(aminomethyl)-3-fluorocyclopentyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167735791) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is 3-[6-[[[(1S,3R)-3-(aminomethyl)-3-fluorocyclopentyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[[(1S,3R)-3-(aminomethyl)-3-fluorocyclopentyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167735791 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[6-[[[(1S,3R)-3-(aminomethyl)-3-fluorocyclopentyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC[C@@]1(F)CC[C@H](NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C20H25FN4O3/c21-20(11-22)6-5-14(8-20)23-9-12-1-2-15-13(7-12)10-25(19(15)28)16-3-4-17(26)24-18(16)27/h1-2,7,14,16,23H,3-6,8-11,22H2,(H,24,26,27)/t14-,16?,20+/m0/s1 |
| InChIKey | DMGMVCFZEDMCHY-MEYYYXTJSA-N |
| XLogP | 0.76 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|