C20H27N3O5Si — CID 176886253
1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carbaldehyde (PubChem CID 176886253) has the molecular formula C20H27N3O5Si and a molecular weight of 417.54 g/mol. Its IUPAC name is 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carbaldehyde.
| Compound Name | 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 176886253 |
| Molecular Formula | C20H27N3O5Si |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carbaldehyde |
| SMILES | Cn1c(=O)n(C2CCC(=O)N(COCC[Si](C)(C)C)C2=O)c2ccc(C=O)cc21 |
| InChI | InChI=1S/C20H27N3O5Si/c1-21-17-11-14(12-24)5-6-15(17)23(20(21)27)16-7-8-18(25)22(19(16)26)13-28-9-10-29(2,3)4/h5-6,11-12,16H,7-10,13H2,1-4H3 |
| InChIKey | FLUPZBVRZWUMAS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|