C27H41N5O4Si — CID 176886294
3-[7-[methyl(piperidin-4-yl)amino]-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 176886294) has the molecular formula C27H41N5O4Si and a molecular weight of 527.74 g/mol. Its IUPAC name is 3-[7-[methyl(piperidin-4-yl)amino]-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-[7-[methyl(piperidin-4-yl)amino]-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176886294 |
| Molecular Formula | C27H41N5O4Si |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 3-[7-[methyl(piperidin-4-yl)amino]-2-oxo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl]-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | CN(c1ccc2c3c1CCCn3c(=O)n2C1CCC(=O)N(COCC[Si](C)(C)C)C1=O)C1CCNCC1 |
| InChI | InChI=1S/C27H41N5O4Si/c1-29(19-11-13-28-14-12-19)21-7-8-22-25-20(21)6-5-15-30(25)27(35)32(22)23-9-10-24(33)31(26(23)34)18-36-16-17-37(2,3)4/h7-8,19,23,28H,5-6,9-18H2,1-4H3 |
| InChIKey | BDEQJQDJBZAWKJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|