C16H30N2O3Si — CID 174035651
3-(2-methylidenebutylamino)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 174035651) has the molecular formula C16H30N2O3Si and a molecular weight of 326.51 g/mol. Its IUPAC name is 3-(2-methylidenebutylamino)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-(2-methylidenebutylamino)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 174035651 |
| Molecular Formula | C16H30N2O3Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-(2-methylidenebutylamino)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | C=C(CC)CNC1CCC(=O)N(COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C16H30N2O3Si/c1-6-13(2)11-17-14-7-8-15(19)18(16(14)20)12-21-9-10-22(3,4)5/h14,17H,2,6-12H2,1,3-5H3 |
| InChIKey | YTQCTQVSSVLENJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|