C18H26N2O3Si — CID 58407607
3-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)indazole-5-carbaldehyde (PubChem CID 58407607) has the molecular formula C18H26N2O3Si and a molecular weight of 346.50 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)indazole-5-carbaldehyde.
| Compound Name | 3-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)indazole-5-carbaldehyde |
|---|---|
| PubChem CID | 58407607 |
| Molecular Formula | C18H26N2O3Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1-(2-trimethylsilylethoxymethyl)indazole-5-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1nc(OCC2CC2)c2cc(C=O)ccc21 |
| InChI | InChI=1S/C18H26N2O3Si/c1-24(2,3)9-8-22-13-20-17-7-6-15(11-21)10-16(17)18(19-20)23-12-14-4-5-14/h6-7,10-11,14H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | VIVHLSOVCINPBB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|