C28H36N4O3Si — CID 91326919
3-[2-[3-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde (PubChem CID 91326919) has the molecular formula C28H36N4O3Si and a molecular weight of 504.71 g/mol. Its IUPAC name is 3-[2-[3-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde.
| Compound Name | 3-[2-[3-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde |
|---|---|
| PubChem CID | 91326919 |
| Molecular Formula | C28H36N4O3Si |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 3-[2-[3-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde |
| SMILES | CN1CCN(C(=O)c2cccc(C=Cc3nn(COCC[Si](C)(C)C)c4cc(C=O)ccc34)c2)CC1 |
| InChI | InChI=1S/C28H36N4O3Si/c1-30-12-14-31(15-13-30)28(34)24-7-5-6-22(18-24)9-11-26-25-10-8-23(20-33)19-27(25)32(29-26)21-35-16-17-36(2,3)4/h5-11,18-20H,12-17,21H2,1-4H3 |
| InChIKey | ARAAZBIEXUYQKS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|