C29H32FN3O3SSi — CID 74013916
ethyl 3-fluoro-2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]sulfanylbenzoate (PubChem CID 74013916) has the molecular formula C29H32FN3O3SSi and a molecular weight of 549.74 g/mol. Its IUPAC name is ethyl 3-fluoro-2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]sulfanylbenzoate.
| Compound Name | ethyl 3-fluoro-2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 74013916 |
| Molecular Formula | C29H32FN3O3SSi |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | ethyl 3-fluoro-2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]sulfanylbenzoate |
| SMILES | CCOC(=O)c1cccc(F)c1Sc1ccc2c(C=Cc3ccccn3)nn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C29H32FN3O3SSi/c1-5-36-29(34)24-10-8-11-25(30)28(24)37-22-13-14-23-26(15-12-21-9-6-7-16-31-21)32-33(27(23)19-22)20-35-17-18-38(2,3)4/h6-16,19H,5,17-18,20H2,1-4H3 |
| InChIKey | ZGIRPIQUFNWBDK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|