C28H29N3O4Si — CID 69371167
2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbonyl]benzoic acid (PubChem CID 69371167) has the molecular formula C28H29N3O4Si and a molecular weight of 499.64 g/mol. Its IUPAC name is 2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbonyl]benzoic acid.
| Compound Name | 2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 69371167 |
| Molecular Formula | C28H29N3O4Si |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-[3-(2-pyridin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbonyl]benzoic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C=Cc2ccccn2)c2ccc(C(=O)c3ccccc3C(=O)O)cc21 |
| InChI | InChI=1S/C28H29N3O4Si/c1-36(2,3)17-16-35-19-31-26-18-20(27(32)22-9-4-5-10-23(22)28(33)34)11-13-24(26)25(30-31)14-12-21-8-6-7-15-29-21/h4-15,18H,16-17,19H2,1-3H3,(H,33,34) |
| InChIKey | FQAJTNWGZAPSQB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|