C28H29N5O2Si — CID 68756555
3-[[3-(2-pyrazin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-2-one (PubChem CID 68756555) has the molecular formula C28H29N5O2Si and a molecular weight of 495.66 g/mol. Its IUPAC name is 3-[[3-(2-pyrazin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[3-(2-pyrazin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 68756555 |
| Molecular Formula | C28H29N5O2Si |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 3-[[3-(2-pyrazin-2-ylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-2-one |
| SMILES | C[Si](C)(C)CCOCn1nc(C=Cc2cnccn2)c2ccc(C=C3C(=O)Nc4ccccc43)cc21 |
| InChI | InChI=1S/C28H29N5O2Si/c1-36(2,3)15-14-35-19-33-27-17-20(16-24-22-6-4-5-7-25(22)31-28(24)34)8-10-23(27)26(32-33)11-9-21-18-29-12-13-30-21/h4-13,16-18H,14-15,19H2,1-3H3,(H,31,34) |
| InChIKey | VTIVLPZFTFHUNR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|