C17H15NO — CID 58923998
(3Z)-3-[(3,4-dimethylphenyl)methylidene]-1H-indol-2-one (PubChem CID 58923998) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethylphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,4-dimethylphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 58923998 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (3Z)-3-[(3,4-dimethylphenyl)methylidene]-1H-indol-2-one |
| SMILES | Cc1ccc(/C=C2\C(=O)Nc3ccccc32)cc1C |
| InChI | InChI=1S/C17H15NO/c1-11-7-8-13(9-12(11)2)10-15-14-5-3-4-6-16(14)18-17(15)19/h3-10H,1-2H3,(H,18,19)/b15-10- |
| InChIKey | MLTVGMKTZVOOMQ-GDNBJRDFSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|