C31H45N5O3Si2 — CID 87800832
2-methyl-5-[1-(2-trimethylsilylethoxymethyl)-3-[(E)-2-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethenyl]indazol-6-yl]oxyaniline (PubChem CID 87800832) has the molecular formula C31H45N5O3Si2 and a molecular weight of 591.91 g/mol. Its IUPAC name is 2-methyl-5-[1-(2-trimethylsilylethoxymethyl)-3-[(E)-2-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethenyl]indazol-6-yl]oxyaniline.
| Compound Name | 2-methyl-5-[1-(2-trimethylsilylethoxymethyl)-3-[(E)-2-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethenyl]indazol-6-yl]oxyaniline |
|---|---|
| PubChem CID | 87800832 |
| Molecular Formula | C31H45N5O3Si2 |
| Molecular Weight | 591.91 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 2-methyl-5-[1-(2-trimethylsilylethoxymethyl)-3-[(E)-2-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethenyl]indazol-6-yl]oxyaniline |
| SMILES | Cc1ccc(Oc2ccc3c(/C=C/c4nccn4COCC[Si](C)(C)C)nn(COCC[Si](C)(C)C)c3c2)cc1N |
| InChI | InChI=1S/C31H45N5O3Si2/c1-24-8-9-25(20-28(24)32)39-26-10-11-27-29(34-36(30(27)21-26)23-38-17-19-41(5,6)7)12-13-31-33-14-15-35(31)22-37-16-18-40(2,3)4/h8-15,20-21H,16-19,22-23,32H2,1-7H3/b13-12+ |
| InChIKey | JPRGEOHBEXEOCZ-OUKQBFOZSA-N |
| XLogP | 7.71 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.91 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|