C30H35N3O6Si — CID 69370102
2-[[6-[3-methoxy-4-(methoxymethoxy)phenyl]-3-[2-(4-nitrophenyl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 69370102) has the molecular formula C30H35N3O6Si and a molecular weight of 561.71 g/mol. Its IUPAC name is 2-[[6-[3-methoxy-4-(methoxymethoxy)phenyl]-3-[2-(4-nitrophenyl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[3-methoxy-4-(methoxymethoxy)phenyl]-3-[2-(4-nitrophenyl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 69370102 |
| Molecular Formula | C30H35N3O6Si |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 2-[[6-[3-methoxy-4-(methoxymethoxy)phenyl]-3-[2-(4-nitrophenyl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COCOc1ccc(-c2ccc3c(C=Cc4ccc([N+](=O)[O-])cc4)nn(COCC[Si](C)(C)C)c3c2)cc1OC |
| InChI | InChI=1S/C30H35N3O6Si/c1-36-21-39-29-15-10-24(19-30(29)37-2)23-9-13-26-27(14-8-22-6-11-25(12-7-22)33(34)35)31-32(28(26)18-23)20-38-16-17-40(3,4)5/h6-15,18-19H,16-17,20-21H2,1-5H3 |
| InChIKey | BWDMXYWHZUYBPM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 97.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|