C22H27N3O3Si — CID 69371667
3-[2-(1,3-benzodioxol-5-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-amine (PubChem CID 69371667) has the molecular formula C22H27N3O3Si and a molecular weight of 409.56 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-amine.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-amine |
|---|---|
| PubChem CID | 69371667 |
| Molecular Formula | C22H27N3O3Si |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(C=Cc2ccc3c(c2)OCO3)c2ccc(N)cc21 |
| InChI | InChI=1S/C22H27N3O3Si/c1-29(2,3)11-10-26-14-25-20-13-17(23)6-7-18(20)19(24-25)8-4-16-5-9-21-22(12-16)28-15-27-21/h4-9,12-13H,10-11,14-15,23H2,1-3H3 |
| InChIKey | KJWXLSOUTXPEFK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|