C32H49N3O2Si2 — CID 69472068
tert-butyl-dimethyl-[1-[3-(2-phenylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]oxysilane (PubChem CID 69472068) has the molecular formula C32H49N3O2Si2 and a molecular weight of 563.94 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-[3-(2-phenylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-[3-(2-phenylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]oxysilane |
|---|---|
| PubChem CID | 69472068 |
| Molecular Formula | C32H49N3O2Si2 |
| Molecular Weight | 563.94 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | tert-butyl-dimethyl-[1-[3-(2-phenylethenyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(c2ccc3c(c2)c(C=Cc2ccccc2)nn3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C32H49N3O2Si2/c1-32(2,3)39(7,8)37-28-18-20-34(21-19-28)27-15-17-31-29(24-27)30(16-14-26-12-10-9-11-13-26)33-35(31)25-36-22-23-38(4,5)6/h9-17,24,28H,18-23,25H2,1-8H3 |
| InChIKey | DZALHMRWBXLVOH-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.94 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|