C21H34N2O4Si — CID 175354798
[7-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3,4-dihydro-2H-chromen-3-yl] carbamate (PubChem CID 175354798) has the molecular formula C21H34N2O4Si and a molecular weight of 406.60 g/mol. Its IUPAC name is [7-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3,4-dihydro-2H-chromen-3-yl] carbamate.
| Compound Name | [7-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3,4-dihydro-2H-chromen-3-yl] carbamate |
|---|---|
| PubChem CID | 175354798 |
| Molecular Formula | C21H34N2O4Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [7-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3,4-dihydro-2H-chromen-3-yl] carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(c2ccc3c(c2)OCC(OC(N)=O)C3)CC1 |
| InChI | InChI=1S/C21H34N2O4Si/c1-21(2,3)28(4,5)27-17-8-10-23(11-9-17)16-7-6-15-12-18(26-20(22)24)14-25-19(15)13-16/h6-7,13,17-18H,8-12,14H2,1-5H3,(H2,22,24) |
| InChIKey | HCINMIVJKOJQKM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|