C15H28N4OSi — CID 140876676
6-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]pyridazin-3-amine (PubChem CID 140876676) has the molecular formula C15H28N4OSi and a molecular weight of 308.50 g/mol. Its IUPAC name is 6-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]pyridazin-3-amine.
| Compound Name | 6-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 140876676 |
| Molecular Formula | C15H28N4OSi |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 6-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]pyridazin-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCN(c2ccc(N)nn2)C1 |
| InChI | InChI=1S/C15H28N4OSi/c1-15(2,3)21(4,5)20-12-7-6-10-19(11-12)14-9-8-13(16)17-18-14/h8-9,12H,6-7,10-11H2,1-5H3,(H2,16,17) |
| InChIKey | WUUSYWBSUADBBU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|