C17H32N4OSi — CID 140876652
6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylpiperidin-1-yl]pyridazin-3-amine (PubChem CID 140876652) has the molecular formula C17H32N4OSi and a molecular weight of 336.56 g/mol. Its IUPAC name is 6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylpiperidin-1-yl]pyridazin-3-amine.
| Compound Name | 6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylpiperidin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 140876652 |
| Molecular Formula | C17H32N4OSi |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylpiperidin-1-yl]pyridazin-3-amine |
| SMILES | CC1(CO[Si](C)(C)C(C)(C)C)CCN(c2ccc(N)nn2)CC1 |
| InChI | InChI=1S/C17H32N4OSi/c1-16(2,3)23(5,6)22-13-17(4)9-11-21(12-10-17)15-8-7-14(18)19-20-15/h7-8H,9-13H2,1-6H3,(H2,18,19) |
| InChIKey | HDVRHXSLJJOTPN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|