C9H16ClN5 — CID 127262604
6-(4-methylpiperazin-1-yl)pyridazin-3-amine;hydrochloride (PubChem CID 127262604) has the molecular formula C9H16ClN5 and a molecular weight of 229.72 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)pyridazin-3-amine;hydrochloride.
| Compound Name | 6-(4-methylpiperazin-1-yl)pyridazin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 127262604 |
| Molecular Formula | C9H16ClN5 |
| Molecular Weight | 229.72 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)pyridazin-3-amine;hydrochloride |
| SMILES | CN1CCN(c2ccc(N)nn2)CC1.Cl |
| InChI | InChI=1S/C9H15N5.ClH/c1-13-4-6-14(7-5-13)9-3-2-8(10)11-12-9;/h2-3H,4-7H2,1H3,(H2,10,11);1H |
| InChIKey | TYIGAFICKCQFRS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.72 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |